Bài 36: Nước

hnamyuh
25 tháng 5 lúc 11:24

Nước bắp cải tím là chất chỉ thị màu pH : 

- pH <7 (axit) : nước cốt chanh, giấm ăn thì làm chuyển sang màu đỏ, hoặc đỏ tím

- pH = 7(trung tính) : muối ăn thì làm chuyển màu tím

- pH > 7(bazo) : vôi ăn trầu, nước xà phòng thì làm chuyển sang màu xanh, xanh lá

Bình luận (0)
D-low_Beatbox
25 tháng 5 lúc 12:31

Nước bắp cải tím khi đổ vào nước cốt chanh sẽ cho ra màu hồng đậm

Vào giấm ăn sẽ có màu hồng nhạt

Mình biết mỗi thế :P

Bình luận (0)
hnamyuh
25 tháng 5 lúc 10:44

1)

a) Kim loại tan dần, chạy tròn trên mặt nước, xuất hiện khí không màu không mùi.

$2Na + 2H_2O \to 2NaOH + H_2$
$2K + 2H_2O \to 2KOH + H_2$

b) n Na = 4,6/23 = 0,2(mol) ; n K = 3,9/39 = 0,1(mol)

n H2 = 1/2 n Na + 1/2 n K = 0,15(mol)

V H2 = 0,15.22,4 = 3,36 lít

Bình luận (0)
hnamyuh
25 tháng 5 lúc 10:46

2)

a)

$Ba + 2H_2O \to Ba(OH)_2 + H_2$
$H_2 + CuO \xrightarrow{t^o} Cu + H_2O$

b) n H2 = n Ba = 6,85/137 = 0,05(mol)

V H2 = 0,05.22,4 = 1,12(lít)

c) 

Ta thấy : 

n CuO / 1 = 8/80 = 0,1(mol) < n H2 / 1 = 0,05 nên CuO dư

n CuO pư = n Cu = n H2 = 0,05(mol)

Suy ra  : 

m = m CuO dư + m Cu = (8 - 0,05.80) + 0,05.64 = 7,2(gam)

Bình luận (0)
hnamyuh
25 tháng 5 lúc 10:55

a) Viên nén canxinol khi thả nào nước xảy ra phản ứng của axit với canxi cacbonat giải phóng khí CO2 nên viên nén tan nhanh và sủi bọt

b)

Nước có vai trò là chất môi trường, là điều kiện để xảy ra phản ứng là trong môi trường dung dịch

Do đó, để bảo quản viên thuốc thì không để viên thuộc tiếp xúc gần và phải cách xa nguồn nước.

Bình luận (0)
hnamyuh
24 tháng 5 lúc 21:31

Chọn phương án 2

Phương án thứ nhất, khi cho CaO vào nước tạo Ca(OH)2 và tỏa nhiệt mạnh khiến bỏng nặng hơn

$CaO + H_2O \to Ca(OH)_2$

Phương án thứ hai làm mất đi bột CaO,làm trung hòa ngay Ca(OH)2 mới tạo ra

$Ca(OH)_2 + 2NH_4Cl \to CaCl_2 + 2NH_3 + 2H_2O$

Bình luận (0)
Dân Chơi Đất Bắc=))))
24 tháng 5 lúc 21:29

Tham Khảo:

Nên dùng phương pháp 2.

Khi dùng phương pháp 1 thì vôi bột tác dụng với H2OH2O phản ứng này tỏa nhiệt và tạo ra Ca(OH)2Ca(OH)2 gây bỏng da.

CaO+H2O→Ca(OH)2CaO+H2O→Ca(OH)2

Khi dùng phương pháp 2, lau khô giúp loại bỏ bớt CaOCaO; sau đó dùng một dung dịch có tính axit giúp trung hòa bớt Ca(OH)2Ca(OH)2 tạo ra

Ca(OH)2+2NH4Cl→CaCl2+2NH3+2H2OCa(OH)2+2NH4Cl→CaCl2+2NH3+2H2O

Ca(OH)2+2CH3COOH→(CH3COO)2Ca+2H2O

Bình luận (0)
hnamyuh
24 tháng 5 lúc 21:01

a)

SO3 + H2O $\to$ H2SO4

n H2SO4 = n SO3 = 240/80 = 3(mol)

m H2SO4 = 3.98 = 294(gam)

b)

2H2 + O2 $\xrightarrow{t^o}$ 2H2O

V H2 / 2 = 0,56 < V O2 = 1,68 nên O2 dư

n H2O = n H2 = 1,12/22,4 = 0,05(mol)

m H2O = 0,05.18 = 0,9(gam)

V H2O = m/D = 0,9/1 = 0,9(ml)

c)

n NaOH = 16/40 = 0,4(mol)

Na2O + H2O $\to$ 2NaOH

n Na2O = 1/2 n NaOH = 0,2(mol)
m Na2O = 0,2.62 = 12,4(gam)

Bình luận (2)
New Champion
24 tháng 5 lúc 21:12

a)Ta có PT:SO4+H2O=H2SO4

Theo bài ra t có nSO4=240:96=2,5

Mà nSo4=nH2So4=2,5 mol

suy ra:mH2So4=2,5.98=245g

 

 

Bình luận (0)
New Champion
24 tháng 5 lúc 21:19

ta có PT 2H2+O2=2H2O

nH2=1,12:22,4=0,05MOL

nO2=1,68:22.4=0,075mol

theo pt ta có 0,05:2<0,075:1

suy ra H2 hết,O2 dư.

theo PT ta có:nH2O=nH2=0,05mol

suy ra VH2O=.....

mH2O=.....

Bình luận (0)
Phạm Uyên
24 tháng 5 lúc 22:48

a, Cho tác dụng với  dd Na2CO3

=> tạo khí: HNO3:  Na2CO3 +HNO3 --> 2NaNO3 +H2O +CO2

=> tạo ktua trắng: Ba(OH)2+Na2CO3 --> BaCO3+2NaOH

=> ko hiện tượng: NaCl

b, Cho tác dụng với Ba(HCO3)2

=> tạo ktua trắng: NaOH:    2NaOH+Ba(HCO3)2 --> BaCO3+Na2CO3+2H2O

=> tạo ktua trắng và khí ko màu: H2SO4: H2SO4+Ba(HCO3)2 --> BaSO4+2H2O+2CO2

=> ko hiện tượng: NaCl

c, Cho tác dụng với CuCl2

=> tạo ktua: KOH: 2KOH+CuCl2 --> Cu(OH)2+2KCl

=> ko hiện tượng: KNO3; HCl

- Cho phần ko hiện tượng tác dụng với Fe

=> tạo khí: Fe+2HCl --> FeCl2+H2

=> ko ht: KNO3

d, Cho tác dụng với Ba(HCO3)2

=> tạo ktua+khí ko màu: H2SO4: Ba(HCO3)2+H2SO4 --> BaSO4+2H2O+2CO2

=> tạo ktua: Na2SO4; NaOH

Na2SO4+Ba(HCO3)2 --> BaSO4+2NaHCO3

2NaOH+Ba(HCO3)2 --> BaCO3+Na2CO3+2H2O

- Sục CO2 vào phần ktua thu được

=> Ktua ko tan: Na2SO4

=> ktua tan: NaOH: BaCO3+CO2+H2O --> Ba(HCO3)2

Bình luận (0)
hnamyuh
12 tháng 5 lúc 11:56

a) $2Na + 2H_2O \to 2NaOH + H_2$

b) n Na = 2,3/23 = 0,1(mol)

Theo PTHH :  n H2 = 1/2 n Na = 0,05(mol)

=> V H2 = 0,05.22,4 = 1,12(lít)

c) Vì sau phản ứng thu được 200 gam dung dịch(không có dữ liệu thể tích) nên tính C% dd sau phản ứng

C% NaOH = 0,1.40/200  .100% = 2%

Bình luận (0)
hnamyuh
21 tháng 4 lúc 20:14

\(a) Ca + 2H_2O \to Ca(OH)_2 + H_2\\ CaO + H_2O \to Ca(OH)_2\\ n_{Ca} = n_{H_2} = \dfrac{3,36}{22,4} = 0,15(mol)\\ m_{Ca} = 0,15.40 = 6(gam)\\ \Rightarrow m_{CaO} = 17,2 - 6 = 11,2(gam)\\ b) n_{Ca(OH)_2} = n_{Ca} + n_{CaO} = 0,15 + \dfrac{11,2}{56} = 0,35(mol)\\ m_{Ca(OH)_2} = 0,35.74 = 25,9(gam)\)

Bình luận (1)
hnamyuh
8 tháng 4 lúc 15:03

\(a) m_{Cu} = 9,6(gam)\\ n_{Al} = a(mol) ; n_{Fe} = b(mol)\\ \Rightarrow 27a + 56b = 16,55 -9,6 =6,95(1)\\ 2Al + 6HCl \to 2AlCl_3 + 3H_2\\ Fe + 2HCl \to FeCl_2 + H_2\\ n_{H_2} = 1,5a + b = \dfrac{3,92}{22,4} = 0,175(2)\\ (1)(2) \Rightarrow a = 0,05 ; b = 0,1\\ m_{Al} = 0,05.27 = 1,35(gam); n_{Fe} = 0,1.56 = 5,6(gam)\)

\(b) n_{HCl} = 2n_{H_2} = 0,175.2 = 0,35(mol) \Rightarrow m_{HCl} = 0,35.36,5 = 12,775(gam)\)

Bình luận (0)

Khoá học trên OLM của Đại học Sư phạm HN

Loading...

Khoá học trên OLM của Đại học Sư phạm HN